C47H69N3O4 — CID 141407506
1,1,3-tris[(3,5-ditert-butylphenyl)-hydroxymethyl]-3-isocyanourea (PubChem CID 141407506) has the molecular formula C47H69N3O4 and a molecular weight of 740.09 g/mol. Its IUPAC name is 1,1,3-tris[(3,5-ditert-butylphenyl)-hydroxymethyl]-3-isocyanourea.
| Compound Name | 1,1,3-tris[(3,5-ditert-butylphenyl)-hydroxymethyl]-3-isocyanourea |
|---|---|
| PubChem CID | 141407506 |
| Molecular Formula | C47H69N3O4 |
| Molecular Weight | 740.09 g/mol |
| Exact Mass | 739.53 |
| IUPAC Name | 1,1,3-tris[(3,5-ditert-butylphenyl)-hydroxymethyl]-3-isocyanourea |
| SMILES | [C-]#[N+]N(C(=O)N(C(O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1)C(O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1)C(O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H69N3O4/c1-42(2,3)32-20-29(21-33(26-32)43(4,5)6)38(51)49(39(52)30-22-34(44(7,8)9)27-35(23-30)45(10,11)12)41(54)50(48-19)40(53)31-24-36(46(13,14)15)28-37(25-31)47(16,17)18/h20-28,38-40,51-53H,1-18H3 |
| InChIKey | MAJQHWCDYKADRO-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.09 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|