C6H6O7 — CID 141418422
[(5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dioxooxolan-2-ylidene]-oxidooxidanium (PubChem CID 141418422) has the molecular formula C6H6O7 and a molecular weight of 190.11 g/mol. Its IUPAC name is [(5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dioxooxolan-2-ylidene]-oxidooxidanium.
| Compound Name | [(5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dioxooxolan-2-ylidene]-oxidooxidanium |
|---|---|
| PubChem CID | 141418422 |
| Molecular Formula | C6H6O7 |
| Molecular Weight | 190.11 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | [(5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dioxooxolan-2-ylidene]-oxidooxidanium |
| SMILES | O=C1C(=O)[C@@H]([C@@H](O)CO)O/C1=[O+]\[O-] |
| InChI | InChI=1S/C6H6O7/c7-1-2(8)5-3(9)4(10)6(12-5)13-11/h2,5,7-8H,1H2/t2-,5+/m0/s1 |
| InChIKey | CKFPOFAILBHXPP-JLAZNSOCSA-N |
| XLogP | -3.79 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.11 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|