C6H10F7NO3S — CID 141492649
dimethylazanium;2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate (PubChem CID 141492649) has the molecular formula C6H10F7NO3S and a molecular weight of 309.20 g/mol. Its IUPAC name is dimethylazanium;2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate.
| Compound Name | dimethylazanium;2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141492649 |
| Molecular Formula | C6H10F7NO3S |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | dimethylazanium;2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H3F7O3S.C2H7N/c5-2(6,1-15(12,13)14)3(7,8)4(9,10)11;1-3-2/h1H2,(H,12,13,14);3H,1-2H3 |
| InChIKey | WHKWUXOQHBZYOW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|