C37H47N3O6 — CID 142167010
2-[(2R)-4-butyl-2-methyl-3,6-dioxo-5-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-(4-phenylbutyl)acetamide (PubChem CID 142167010) has the molecular formula C37H47N3O6 and a molecular weight of 629.80 g/mol. Its IUPAC name is 2-[(2R)-4-butyl-2-methyl-3,6-dioxo-5-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-(4-phenylbutyl)acetamide.
| Compound Name | 2-[(2R)-4-butyl-2-methyl-3,6-dioxo-5-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-(4-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 142167010 |
| Molecular Formula | C37H47N3O6 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | 2-[(2R)-4-butyl-2-methyl-3,6-dioxo-5-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-(4-phenylbutyl)acetamide |
| SMILES | CCCCN1C(=O)[C@@H](C)N(CC(=O)NCCCCc2ccccc2)C(=O)C1Cc1ccc(-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C37H47N3O6/c1-6-7-21-39-31(22-28-16-18-29(19-17-28)30-23-32(44-3)35(46-5)33(24-30)45-4)37(43)40(26(2)36(39)42)25-34(41)38-20-12-11-15-27-13-9-8-10-14-27/h8-10,13-14,16-19,23-24,26,31H,6-7,11-12,15,20-22,25H2,1-5H3,(H,38,41)/t26-,31?/m1/s1 |
| InChIKey | CYEUHGYTZRXVDQ-SYQKMTEESA-N |
| XLogP | 5.29 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|