C28H34N2O5 — CID 142167028
(6S)-1-[(2E,4E)-hexa-2,4-dienyl]-4,6-dimethyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione (PubChem CID 142167028) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is (6S)-1-[(2E,4E)-hexa-2,4-dienyl]-4,6-dimethyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione.
| Compound Name | (6S)-1-[(2E,4E)-hexa-2,4-dienyl]-4,6-dimethyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 142167028 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (6S)-1-[(2E,4E)-hexa-2,4-dienyl]-4,6-dimethyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
| SMILES | C/C=C/C=C/CN1C(=O)C(Cc2ccc(-c3cc(OC)c(OC)c(OC)c3)cc2)N(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C28H34N2O5/c1-7-8-9-10-15-30-19(2)27(31)29(3)23(28(30)32)16-20-11-13-21(14-12-20)22-17-24(33-4)26(35-6)25(18-22)34-5/h7-14,17-19,23H,15-16H2,1-6H3/b8-7+,10-9+/t19-,23?/m0/s1 |
| InChIKey | OFRNVMJDIAQNPR-NIEXOINVSA-N |
| XLogP | 4.11 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|