C30H41N5O4 — CID 142273972
N-[2-[3-(dimethylamino)propylamino]-4-methoxy-6-oxo-1H-pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2H-inden-5-yl)methyl]furan-2-carboxamide (PubChem CID 142273972) has the molecular formula C30H41N5O4 and a molecular weight of 535.69 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propylamino]-4-methoxy-6-oxo-1H-pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2H-inden-5-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-[3-(dimethylamino)propylamino]-4-methoxy-6-oxo-1H-pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2H-inden-5-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 142273972 |
| Molecular Formula | C30H41N5O4 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | N-[2-[3-(dimethylamino)propylamino]-4-methoxy-6-oxo-1H-pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2H-inden-5-yl)methyl]furan-2-carboxamide |
| SMILES | COc1nc(NCCCN(C)C)[nH]c(=O)c1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)CC3(C)C)o1 |
| InChI | InChI=1S/C30H41N5O4/c1-18-14-21-22(30(4,5)17-29(21,2)3)16-19(18)15-20-10-11-23(39-20)25(36)32-24-26(37)33-28(34-27(24)38-8)31-12-9-13-35(6)7/h10-11,14,16H,9,12-13,15,17H2,1-8H3,(H,32,36)(H2,31,33,34,37) |
| InChIKey | CEUWRFBICLILEX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|