C10H11BrClNO — CID 142375509
8-bromo-2,3-dihydro-1,4-benzoxazepine;chloromethane (PubChem CID 142375509) has the molecular formula C10H11BrClNO and a molecular weight of 276.56 g/mol. Its IUPAC name is 8-bromo-2,3-dihydro-1,4-benzoxazepine;chloromethane.
| Compound Name | 8-bromo-2,3-dihydro-1,4-benzoxazepine;chloromethane |
|---|---|
| PubChem CID | 142375509 |
| Molecular Formula | C10H11BrClNO |
| Molecular Weight | 276.56 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 8-bromo-2,3-dihydro-1,4-benzoxazepine;chloromethane |
| SMILES | Brc1ccc2c(c1)OCCN=C2.CCl |
| InChI | InChI=1S/C9H8BrNO.CH3Cl/c10-8-2-1-7-6-11-3-4-12-9(7)5-8;1-2/h1-2,5-6H,3-4H2;1H3 |
| InChIKey | MCKJJUFLNBBOCZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|