C24H15ClN2 — CID 142505072
4-chloro-1-naphthalen-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)phthalazine (PubChem CID 142505072) has the molecular formula C24H15ClN2 and a molecular weight of 371.88 g/mol. Its IUPAC name is 4-chloro-1-naphthalen-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)phthalazine.
| Compound Name | 4-chloro-1-naphthalen-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)phthalazine |
|---|---|
| PubChem CID | 142505072 |
| Molecular Formula | C24H15ClN2 |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-chloro-1-naphthalen-2-yl-6-(2,3,4,5,6-pentadeuteriophenyl)phthalazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-c4ccc5ccccc5c4)nnc(Cl)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C24H15ClN2/c25-24-22-15-19(16-6-2-1-3-7-16)12-13-21(22)23(26-27-24)20-11-10-17-8-4-5-9-18(17)14-20/h1-15H/i1D,2D,3D,6D,7D |
| InChIKey | BRBZPOVBLQKMKT-FSTBWYLISA-N |
| XLogP | 6.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |