C18H24ClN7 — CID 142537385
4-N-[5-chloro-2-(5-ethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-2-methanimidoylbenzene-1,4-diamine (PubChem CID 142537385) has the molecular formula C18H24ClN7 and a molecular weight of 373.89 g/mol. Its IUPAC name is 4-N-[5-chloro-2-(5-ethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-2-methanimidoylbenzene-1,4-diamine.
| Compound Name | 4-N-[5-chloro-2-(5-ethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-2-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 142537385 |
| Molecular Formula | C18H24ClN7 |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-N-[5-chloro-2-(5-ethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-2-methanimidoylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2nc(N3CCNC(CC)CC3)ncc2Cl)ccc1N |
| InChI | InChI=1S/C18H24ClN7/c1-2-13-5-7-26(8-6-22-13)18-23-11-15(19)17(25-18)24-14-3-4-16(21)12(9-14)10-20/h3-4,9-11,13,20,22H,2,5-8,21H2,1H3,(H,23,24,25)/b20-10+ |
| InChIKey | MTWQCJVGKMGOFJ-KEBDBYFISA-N |
| XLogP | 3.03 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|