C34H38ClF2N2OP — CID 142814697
3-[3-[[2-chloro-3-[difluoro(phosphanyl)methyl]phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-propan-2-ylaniline (PubChem CID 142814697) has the molecular formula C34H38ClF2N2OP and a molecular weight of 595.11 g/mol. Its IUPAC name is 3-[3-[[2-chloro-3-[difluoro(phosphanyl)methyl]phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-propan-2-ylaniline.
| Compound Name | 3-[3-[[2-chloro-3-[difluoro(phosphanyl)methyl]phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 142814697 |
| Molecular Formula | C34H38ClF2N2OP |
| Molecular Weight | 595.11 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 3-[3-[[2-chloro-3-[difluoro(phosphanyl)methyl]phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-propan-2-ylaniline |
| SMILES | CC(C)Nc1cccc(OCCCN(Cc2cccc(C(F)(F)P)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C34H38ClF2N2OP/c1-25(2)38-29-17-10-18-30(22-29)40-21-11-20-39(23-28-16-9-19-32(33(28)35)34(36,37)41)24-31(26-12-5-3-6-13-26)27-14-7-4-8-15-27/h3-10,12-19,22,25,31,38H,11,20-21,23-24,41H2,1-2H3 |
| InChIKey | QURVKZUTZOHJNK-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.11 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|