C15H18O — CID 142927052
1-ethyl-2-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]benzene (PubChem CID 142927052) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-ethyl-2-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]benzene.
| Compound Name | 1-ethyl-2-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 142927052 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-ethyl-2-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]benzene |
| SMILES | C=C/C=C\C(=C)OCc1ccccc1CC |
| InChI | InChI=1S/C15H18O/c1-4-6-9-13(3)16-12-15-11-8-7-10-14(15)5-2/h4,6-11H,1,3,5,12H2,2H3/b9-6- |
| InChIKey | LIDQKQXBVKMERN-TWGQIWQCSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|