C17H21N — CID 142946827
N-[(1E)-2-(2,2-dimethyl-1,3-dihydroinden-5-yl)buta-1,3-dienyl]ethanimine (PubChem CID 142946827) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(1E)-2-(2,2-dimethyl-1,3-dihydroinden-5-yl)buta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E)-2-(2,2-dimethyl-1,3-dihydroinden-5-yl)buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 142946827 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-[(1E)-2-(2,2-dimethyl-1,3-dihydroinden-5-yl)buta-1,3-dienyl]ethanimine |
| SMILES | C=C/C(=C\N=C\C)c1ccc2c(c1)CC(C)(C)C2 |
| InChI | InChI=1S/C17H21N/c1-5-13(12-18-6-2)14-7-8-15-10-17(3,4)11-16(15)9-14/h5-9,12H,1,10-11H2,2-4H3/b13-12+,18-6+ |
| InChIKey | KUWFGVIVZUKHKL-UEFSIDPBSA-N |
| XLogP | 4.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|