C22H38O2 — CID 143260568
[2,4-ditert-butyl-6-[(Z)-prop-1-enyl]phenyl] formate;ethane (PubChem CID 143260568) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-[(Z)-prop-1-enyl]phenyl] formate;ethane.
| Compound Name | [2,4-ditert-butyl-6-[(Z)-prop-1-enyl]phenyl] formate;ethane |
|---|---|
| PubChem CID | 143260568 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | [2,4-ditert-butyl-6-[(Z)-prop-1-enyl]phenyl] formate;ethane |
| SMILES | C/C=C\c1cc(C(C)(C)C)cc(C(C)(C)C)c1OC=O.CC.CC |
| InChI | InChI=1S/C18H26O2.2C2H6/c1-8-9-13-10-14(17(2,3)4)11-15(18(5,6)7)16(13)20-12-19;2*1-2/h8-12H,1-7H3;2*1-2H3/b9-8-;; |
| InChIKey | PJGMLOBFRWQUQA-ULDSSAIZSA-N |
| XLogP | 6.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|