C20H30N2S — CID 143293072
(Z)-3-[2,6-di(propan-2-yl)phenyl]imino-1-[(E)-2-methylbut-2-enyl]sulfanylprop-1-en-2-amine (PubChem CID 143293072) has the molecular formula C20H30N2S and a molecular weight of 330.54 g/mol. Its IUPAC name is (Z)-3-[2,6-di(propan-2-yl)phenyl]imino-1-[(E)-2-methylbut-2-enyl]sulfanylprop-1-en-2-amine.
| Compound Name | (Z)-3-[2,6-di(propan-2-yl)phenyl]imino-1-[(E)-2-methylbut-2-enyl]sulfanylprop-1-en-2-amine |
|---|---|
| PubChem CID | 143293072 |
| Molecular Formula | C20H30N2S |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (Z)-3-[2,6-di(propan-2-yl)phenyl]imino-1-[(E)-2-methylbut-2-enyl]sulfanylprop-1-en-2-amine |
| SMILES | C/C=C(\C)CS/C=C(N)/C=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H30N2S/c1-7-16(6)12-23-13-17(21)11-22-20-18(14(2)3)9-8-10-19(20)15(4)5/h7-11,13-15H,12,21H2,1-6H3/b16-7+,17-13-,22-11+ |
| InChIKey | DQFYIEIOAIROFX-CVLFTYHESA-N |
| XLogP | 6.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|