C28H42N2 — CID 143344870
(8E)-N-[(3E)-5-[(2E)-hexa-2,5-dien-2-yl]imino-3,6-dimethylhepta-1,3,6-trien-2-yl]-8,9-dimethylundeca-1,8,10-trien-4-amine (PubChem CID 143344870) has the molecular formula C28H42N2 and a molecular weight of 406.66 g/mol. Its IUPAC name is (8E)-N-[(3E)-5-[(2E)-hexa-2,5-dien-2-yl]imino-3,6-dimethylhepta-1,3,6-trien-2-yl]-8,9-dimethylundeca-1,8,10-trien-4-amine.
| Compound Name | (8E)-N-[(3E)-5-[(2E)-hexa-2,5-dien-2-yl]imino-3,6-dimethylhepta-1,3,6-trien-2-yl]-8,9-dimethylundeca-1,8,10-trien-4-amine |
|---|---|
| PubChem CID | 143344870 |
| Molecular Formula | C28H42N2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (8E)-N-[(3E)-5-[(2E)-hexa-2,5-dien-2-yl]imino-3,6-dimethylhepta-1,3,6-trien-2-yl]-8,9-dimethylundeca-1,8,10-trien-4-amine |
| SMILES | C=CC/C=C(C)/N=C(/C=C(\C)C(=C)NC(CC=C)CCC/C(C)=C(\C)C=C)C(=C)C |
| InChI | InChI=1S/C28H42N2/c1-11-14-18-25(9)29-28(21(4)5)20-24(8)26(10)30-27(16-12-2)19-15-17-23(7)22(6)13-3/h11-13,18,20,27,30H,1-4,10,14-17,19H2,5-9H3/b23-22+,24-20+,25-18+,29-28- |
| InChIKey | BZMGGBQCYHFBFD-MTYSOYFISA-N |
| XLogP | 8.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|