About 1-cyclohexylethanone;ethane;2-methylnaphthalene
1-cyclohexylethanone;ethane;2-methylnaphthalene (PubChem CID 143467241) has the molecular formula C21H30O
and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-cyclohexylethanone;ethane;2-methylnaphthalene.
Molecular Properties
| Compound Name | 1-cyclohexylethanone;ethane;2-methylnaphthalene |
| PubChem CID | 143467241 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-cyclohexylethanone;ethane;2-methylnaphthalene |
| SMILES | CC.CC(=O)C1CCCCC1.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H10.C8H14O.C2H6/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-7(9)8-5-3-2-4-6-8;1-2/h2-8H,1H3;8H,2-6H2,1H3;1-2H3 |
| InChIKey | DATUWXNWWFANHD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexylethanone;ethane;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanone;ethane;2-methylnaphthalene?
The IUPAC name of 1-cyclohexylethanone;ethane;2-methylnaphthalene (CID 143467241) is 1-cyclohexylethanone;ethane;2-methylnaphthalene.
What is the SMILES notation for 1-cyclohexylethanone;ethane;2-methylnaphthalene?
The canonical SMILES for 1-cyclohexylethanone;ethane;2-methylnaphthalene is CC.CC(=O)C1CCCCC1.Cc1ccc2ccccc2c1.
What is the InChIKey of 1-cyclohexylethanone;ethane;2-methylnaphthalene?
The InChIKey is DATUWXNWWFANHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C8H14O.C2H6/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-7(9)8-5-3-2-4-6-8;1-2/h2-8H,1H3;8H,2-6H2,1H3;1-2H3.
What are the key properties of 1-cyclohexylethanone;ethane;2-methylnaphthalene?
1-cyclohexylethanone;ethane;2-methylnaphthalene has a molecular weight of 298.47 g/mol, XLogP of 6.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanone;ethane;2-methylnaphthalene is sourced from PubChem (CID 143467241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).