C31H33N7O5 — CID 143593669
4,8-diamino-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]oxy]phenyl]-1,5-dihydroxyanthracene-9,10-dione (PubChem CID 143593669) has the molecular formula C31H33N7O5 and a molecular weight of 583.65 g/mol. Its IUPAC name is 4,8-diamino-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]oxy]phenyl]-1,5-dihydroxyanthracene-9,10-dione.
| Compound Name | 4,8-diamino-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]oxy]phenyl]-1,5-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 143593669 |
| Molecular Formula | C31H33N7O5 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 4,8-diamino-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]oxy]phenyl]-1,5-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCNc1nc(NCCCC)nc(Oc2ccc(-c3cc(N)c4c(c3O)C(=O)c3c(N)ccc(O)c3C4=O)cc2)n1 |
| InChI | InChI=1S/C31H33N7O5/c1-3-5-13-34-29-36-30(35-14-6-4-2)38-31(37-29)43-17-9-7-16(8-10-17)18-15-20(33)23-25(26(18)40)28(42)22-19(32)11-12-21(39)24(22)27(23)41/h7-12,15,39-40H,3-6,13-14,32-33H2,1-2H3,(H2,34,35,36,37,38) |
| InChIKey | PREPGIIVEAWLHW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 198.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|