C45H63N3O6S — CID 143625367
4-O-tert-butyl 1-O-methyl 2-[(1-cyclopropylidene-2-formamidoethyl)amino]butanedioate;5-[(2-methylpropan-2-yl)oxy]hex-5-en-2-amine;[methylsulfanyl(diphenyl)methyl]benzene (PubChem CID 143625367) has the molecular formula C45H63N3O6S and a molecular weight of 774.08 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-[(1-cyclopropylidene-2-formamidoethyl)amino]butanedioate;5-[(2-methylpropan-2-yl)oxy]hex-5-en-2-amine;[methylsulfanyl(diphenyl)methyl]benzene.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-[(1-cyclopropylidene-2-formamidoethyl)amino]butanedioate;5-[(2-methylpropan-2-yl)oxy]hex-5-en-2-amine;[methylsulfanyl(diphenyl)methyl]benzene |
|---|---|
| PubChem CID | 143625367 |
| Molecular Formula | C45H63N3O6S |
| Molecular Weight | 774.08 g/mol |
| Exact Mass | 773.44 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-[(1-cyclopropylidene-2-formamidoethyl)amino]butanedioate;5-[(2-methylpropan-2-yl)oxy]hex-5-en-2-amine;[methylsulfanyl(diphenyl)methyl]benzene |
| SMILES | C=C(CCC(C)N)OC(C)(C)C.COC(=O)C(CC(=O)OC(C)(C)C)NC(CNC=O)=C1CC1.CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18S.C15H24N2O5.C10H21NO/c1-21-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-15(2,3)22-13(19)7-11(14(20)21-4)17-12(8-16-9-18)10-5-6-10;1-8(11)6-7-9(2)12-10(3,4)5/h2-16H,1H3;9,11,17H,5-8H2,1-4H3,(H,16,18);8H,2,6-7,11H2,1,3-5H3 |
| InChIKey | LBNZFFNQDUKGOA-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.08 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|