C29H32F6O2 — CID 143642215
(3Z,7Z)-5,6-dimethylidene-2-[(2Z,4Z)-5-methyl-3-(trifluoromethyl)hepta-2,4-dien-2-yl]oxy-9-[(3E)-5-methyl-3-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxydeca-1,3,7,9-tetraene (PubChem CID 143642215) has the molecular formula C29H32F6O2 and a molecular weight of 526.56 g/mol. Its IUPAC name is (3Z,7Z)-5,6-dimethylidene-2-[(2Z,4Z)-5-methyl-3-(trifluoromethyl)hepta-2,4-dien-2-yl]oxy-9-[(3E)-5-methyl-3-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxydeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7Z)-5,6-dimethylidene-2-[(2Z,4Z)-5-methyl-3-(trifluoromethyl)hepta-2,4-dien-2-yl]oxy-9-[(3E)-5-methyl-3-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxydeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 143642215 |
| Molecular Formula | C29H32F6O2 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (3Z,7Z)-5,6-dimethylidene-2-[(2Z,4Z)-5-methyl-3-(trifluoromethyl)hepta-2,4-dien-2-yl]oxy-9-[(3E)-5-methyl-3-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxydeca-1,3,7,9-tetraene |
| SMILES | C=C(C)/C=C(\C(=C)OC(=C)/C=C\C(=C)C(=C)/C=C\C(=C)O/C(C)=C(/C=C(/C)CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H32F6O2/c1-11-19(4)17-27(29(33,34)35)25(10)37-23(8)15-13-21(6)20(5)12-14-22(7)36-24(9)26(16-18(2)3)28(30,31)32/h12-17H,2,5-9,11H2,1,3-4,10H3/b14-12-,15-13-,19-17-,26-16+,27-25- |
| InChIKey | YAWPPEWUGLTZGL-JDFDRMGNSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|