C12H18N2 — CID 143792395
3-pentan-3-yl-2,3-dihydro-1H-indazole (PubChem CID 143792395) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-pentan-3-yl-2,3-dihydro-1H-indazole.
| Compound Name | 3-pentan-3-yl-2,3-dihydro-1H-indazole |
|---|---|
| PubChem CID | 143792395 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-pentan-3-yl-2,3-dihydro-1H-indazole |
| SMILES | CCC(CC)C1NNc2ccccc21 |
| InChI | InChI=1S/C12H18N2/c1-3-9(4-2)12-10-7-5-6-8-11(10)13-14-12/h5-9,12-14H,3-4H2,1-2H3 |
| InChIKey | LBKVUVQVQLTIQJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |