C8H7N3 — CID 69219149
2,3-dihydro-1H-indazole-3-carbonitrile (PubChem CID 69219149) has the molecular formula C8H7N3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2,3-dihydro-1H-indazole-3-carbonitrile.
| Compound Name | 2,3-dihydro-1H-indazole-3-carbonitrile |
|---|---|
| PubChem CID | 69219149 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 2,3-dihydro-1H-indazole-3-carbonitrile |
| SMILES | N#CC1NNc2ccccc21 |
| InChI | InChI=1S/C8H7N3/c9-5-8-6-3-1-2-4-7(6)10-11-8/h1-4,8,10-11H |
| InChIKey | NUPJKKJPZKBUQX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |