C19H28O — CID 143830194
10-methyl-3-methylidene-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol (PubChem CID 143830194) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 10-methyl-3-methylidene-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | 10-methyl-3-methylidene-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 143830194 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 10-methyl-3-methylidene-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol |
| SMILES | C=C1C=C2CCC3C4CCCC4CC(O)C3C2(C)CC1 |
| InChI | InChI=1S/C19H28O/c1-12-8-9-19(2)14(10-12)6-7-16-15-5-3-4-13(15)11-17(20)18(16)19/h10,13,15-18,20H,1,3-9,11H2,2H3 |
| InChIKey | WJORXHXAOKJOTB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |