C21H32O6 — CID 143869492
(8aS)-2-(4-tert-butylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol;ethyl acetate (PubChem CID 143869492) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (8aS)-2-(4-tert-butylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol;ethyl acetate.
| Compound Name | (8aS)-2-(4-tert-butylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol;ethyl acetate |
|---|---|
| PubChem CID | 143869492 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (8aS)-2-(4-tert-butylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol;ethyl acetate |
| SMILES | CC(C)(C)c1ccc(C2OCC3OCCC(O)[C@@H]3O2)cc1.CCOC(C)=O |
| InChI | InChI=1S/C17H24O4.C4H8O2/c1-17(2,3)12-6-4-11(5-7-12)16-20-10-14-15(21-16)13(18)8-9-19-14;1-3-6-4(2)5/h4-7,13-16,18H,8-10H2,1-3H3;3H2,1-2H3/t13?,14?,15-,16?;/m0./s1 |
| InChIKey | UYUCUIDCZZMCNG-JBSBSVLESA-N |
| XLogP | 3.12 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |