C34H42N2 — CID 143949436
4-tert-butyl-7-(7-tert-butyl-9H-fluoren-2-yl)-2,2-dipropylbenzimidazole (PubChem CID 143949436) has the molecular formula C34H42N2 and a molecular weight of 478.72 g/mol. Its IUPAC name is 4-tert-butyl-7-(7-tert-butyl-9H-fluoren-2-yl)-2,2-dipropylbenzimidazole.
| Compound Name | 4-tert-butyl-7-(7-tert-butyl-9H-fluoren-2-yl)-2,2-dipropylbenzimidazole |
|---|---|
| PubChem CID | 143949436 |
| Molecular Formula | C34H42N2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | 4-tert-butyl-7-(7-tert-butyl-9H-fluoren-2-yl)-2,2-dipropylbenzimidazole |
| SMILES | CCCC1(CCC)N=c2c(-c3ccc4c(c3)Cc3cc(C(C)(C)C)ccc3-4)ccc(C(C)(C)C)c2=N1 |
| InChI | InChI=1S/C34H42N2/c1-9-17-34(18-10-2)35-30-28(15-16-29(31(30)36-34)33(6,7)8)22-11-13-26-23(19-22)20-24-21-25(32(3,4)5)12-14-27(24)26/h11-16,19,21H,9-10,17-18,20H2,1-8H3 |
| InChIKey | HNYRXKDWWWRIQD-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |