C16H31N3 — CID 144512418
ethane;1-(7-ethenyl-6-methyl-2-methylidene-3H-azepin-1-yl)-1,2-dimethylhydrazine (PubChem CID 144512418) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is ethane;1-(7-ethenyl-6-methyl-2-methylidene-3H-azepin-1-yl)-1,2-dimethylhydrazine.
| Compound Name | ethane;1-(7-ethenyl-6-methyl-2-methylidene-3H-azepin-1-yl)-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 144512418 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | ethane;1-(7-ethenyl-6-methyl-2-methylidene-3H-azepin-1-yl)-1,2-dimethylhydrazine |
| SMILES | C=CC1=C(C)C=CCC(=C)N1N(C)NC.CC.CC |
| InChI | InChI=1S/C12H19N3.2C2H6/c1-6-12-10(2)8-7-9-11(3)15(12)14(5)13-4;2*1-2/h6-8,13H,1,3,9H2,2,4-5H3;2*1-2H3 |
| InChIKey | DOMCYNPKIMHLOA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|