C39H61NO7 — CID 144573474
N-[(2S)-1-(4-but-2-ynoxyphenyl)-3-ethoxypropan-2-yl]formamide;[(E,3S)-3-formyl-13-oxoicos-5-enyl] acetate (PubChem CID 144573474) has the molecular formula C39H61NO7 and a molecular weight of 655.92 g/mol. Its IUPAC name is N-[(2S)-1-(4-but-2-ynoxyphenyl)-3-ethoxypropan-2-yl]formamide;[(E,3S)-3-formyl-13-oxoicos-5-enyl] acetate.
| Compound Name | N-[(2S)-1-(4-but-2-ynoxyphenyl)-3-ethoxypropan-2-yl]formamide;[(E,3S)-3-formyl-13-oxoicos-5-enyl] acetate |
|---|---|
| PubChem CID | 144573474 |
| Molecular Formula | C39H61NO7 |
| Molecular Weight | 655.92 g/mol |
| Exact Mass | 655.44 |
| IUPAC Name | N-[(2S)-1-(4-but-2-ynoxyphenyl)-3-ethoxypropan-2-yl]formamide;[(E,3S)-3-formyl-13-oxoicos-5-enyl] acetate |
| SMILES | CC#CCOc1ccc(C[C@@H](COCC)NC=O)cc1.CCCCCCCC(=O)CCCCCC/C=C/C[C@H](C=O)CCOC(C)=O |
| InChI | InChI=1S/C23H40O4.C16H21NO3/c1-3-4-5-9-13-16-23(26)17-14-11-8-6-7-10-12-15-22(20-24)18-19-27-21(2)25;1-3-5-10-20-16-8-6-14(7-9-16)11-15(17-13-18)12-19-4-2/h10,12,20,22H,3-9,11,13-19H2,1-2H3;6-9,13,15H,4,10-12H2,1-2H3,(H,17,18)/b12-10+;/t22-;15-/m00/s1 |
| InChIKey | YGBQOZIUEMLHJI-SLXHFEDRSA-N |
| XLogP | 7.75 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.92 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|