C37H47N3 — CID 144631867
ethane;(2E,4E,6E)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-N-methylidene-1-phenyl-7-[(Z)-prop-1-enyl]deca-2,4,6-triene-1,5,8-triimine;1,4-xylene (PubChem CID 144631867) has the molecular formula C37H47N3 and a molecular weight of 533.80 g/mol. Its IUPAC name is ethane;(2E,4E,6E)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-N-methylidene-1-phenyl-7-[(Z)-prop-1-enyl]deca-2,4,6-triene-1,5,8-triimine;1,4-xylene.
| Compound Name | ethane;(2E,4E,6E)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-N-methylidene-1-phenyl-7-[(Z)-prop-1-enyl]deca-2,4,6-triene-1,5,8-triimine;1,4-xylene |
|---|---|
| PubChem CID | 144631867 |
| Molecular Formula | C37H47N3 |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | ethane;(2E,4E,6E)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-N-methylidene-1-phenyl-7-[(Z)-prop-1-enyl]deca-2,4,6-triene-1,5,8-triimine;1,4-xylene |
| SMILES | CC.Cc1ccc(C)cc1.[H]/N=C(/C=C(\C=C(\C=C(/C=C\C)C(\CC)=N\[H])N=C)C(/C=C)=C/C=C\C)c1ccccc1 |
| InChI | InChI=1S/C27H31N3.C8H10.C2H6/c1-6-10-15-21(8-3)24(20-27(29)22-16-12-11-13-17-22)19-25(30-5)18-23(14-7-2)26(28)9-4;1-7-3-5-8(2)6-4-7;1-2/h6-8,10-20,28-29H,3,5,9H2,1-2,4H3;3-6H,1-2H3;1-2H3/b10-6-,14-7-,21-15+,23-18+,24-20+,25-19+,28-26+,29-27-;; |
| InChIKey | HJLJTKNUGYWHIT-VOIWMWNZSA-N |
| XLogP | 10.52 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|