C30H40FNO3S — CID 144750021
S-[3-(4-fluoro-4-methylpent-1-en-2-yl)oxyprop-2-ynyl] (16R)-11-amino-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioate (PubChem CID 144750021) has the molecular formula C30H40FNO3S and a molecular weight of 513.72 g/mol. Its IUPAC name is S-[3-(4-fluoro-4-methylpent-1-en-2-yl)oxyprop-2-ynyl] (16R)-11-amino-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioate.
| Compound Name | S-[3-(4-fluoro-4-methylpent-1-en-2-yl)oxyprop-2-ynyl] (16R)-11-amino-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioate |
|---|---|
| PubChem CID | 144750021 |
| Molecular Formula | C30H40FNO3S |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | S-[3-(4-fluoro-4-methylpent-1-en-2-yl)oxyprop-2-ynyl] (16R)-11-amino-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioate |
| SMILES | C=C(CC(C)(C)F)OC#CCSC(=O)C1[C@H](C)CC2C3CCC4=CC(=O)C=CC4(C)C3C(N)CC21C |
| InChI | InChI=1S/C30H40FNO3S/c1-18-14-23-22-9-8-20-15-21(33)10-11-29(20,5)26(22)24(32)17-30(23,6)25(18)27(34)36-13-7-12-35-19(2)16-28(3,4)31/h10-11,15,18,22-26H,2,8-9,13-14,16-17,32H2,1,3-6H3/t18-,22?,23?,24?,25?,26?,29?,30?/m1/s1 |
| InChIKey | HXLYAMGVNLEHGG-ISHXCPQCSA-N |
| XLogP | 5.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|