C23H29N4O6PS — CID 144852781
propan-2-yl 2-[[[5-(4-aminothieno[3,4-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 144852781) has the molecular formula C23H29N4O6PS and a molecular weight of 520.55 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(4-aminothieno[3,4-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(4-aminothieno[3,4-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144852781 |
| Molecular Formula | C23H29N4O6PS |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | propan-2-yl 2-[[[5-(4-aminothieno[3,4-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCC1CCC(c2scc3c(N)ncnc23)O1)Oc1ccccc1 |
| InChI | InChI=1S/C23H29N4O6PS/c1-14(2)31-23(28)15(3)27-34(29,33-16-7-5-4-6-8-16)30-11-17-9-10-19(32-17)21-20-18(12-35-21)22(24)26-13-25-20/h4-8,12-15,17,19H,9-11H2,1-3H3,(H,27,29)(H2,24,25,26) |
| InChIKey | UYGNGXMMXKLQMJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|