C40H21O12P — CID 144909937
[4-[(1,3-dioxo-2-benzofuran-5-yl)-hydroxymethoxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)naphthalen-1-yl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 144909937) has the molecular formula C40H21O12P and a molecular weight of 724.57 g/mol. Its IUPAC name is [4-[(1,3-dioxo-2-benzofuran-5-yl)-hydroxymethoxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)naphthalen-1-yl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-[(1,3-dioxo-2-benzofuran-5-yl)-hydroxymethoxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)naphthalen-1-yl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 144909937 |
| Molecular Formula | C40H21O12P |
| Molecular Weight | 724.57 g/mol |
| Exact Mass | 724.08 |
| IUPAC Name | [4-[(1,3-dioxo-2-benzofuran-5-yl)-hydroxymethoxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)naphthalen-1-yl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(Oc1cc(P2(=O)Oc3ccccc3-c3ccccc32)c(OC(O)c2ccc3c(c2)C(=O)OC3=O)c2ccccc12)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C40H21O12P/c41-35(20-13-15-26-28(17-20)39(45)50-37(26)43)48-31-19-33(53(47)32-12-6-4-9-24(32)22-7-3-5-11-30(22)52-53)34(25-10-2-1-8-23(25)31)49-36(42)21-14-16-27-29(18-21)40(46)51-38(27)44/h1-19,36,42H |
| InChIKey | XHTHYVRVJOBKAF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|