C51H45N — CID 145156188
2-(1-bicyclo[4.1.0]hepta-2,4,6-trienyl)-4-[4-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]phenyl]pyridine;(3Z)-6-methylhepta-1,3,5-triene (PubChem CID 145156188) has the molecular formula C51H45N and a molecular weight of 671.93 g/mol. Its IUPAC name is 2-(1-bicyclo[4.1.0]hepta-2,4,6-trienyl)-4-[4-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]phenyl]pyridine;(3Z)-6-methylhepta-1,3,5-triene.
| Compound Name | 2-(1-bicyclo[4.1.0]hepta-2,4,6-trienyl)-4-[4-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]phenyl]pyridine;(3Z)-6-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 145156188 |
| Molecular Formula | C51H45N |
| Molecular Weight | 671.93 g/mol |
| Exact Mass | 671.36 |
| IUPAC Name | 2-(1-bicyclo[4.1.0]hepta-2,4,6-trienyl)-4-[4-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]phenyl]pyridine;(3Z)-6-methylhepta-1,3,5-triene |
| SMILES | C=C(/C=C(\C=C(/C)c1ccccc1)c1ccccc1)c1ccc(-c2ccc(-c3ccnc(C45C=CC=CC4=C5)c3)cc2)cc1.C=C/C=C\C=C(C)C |
| InChI | InChI=1S/C43H33N.C8H12/c1-31(33-11-5-3-6-12-33)27-40(35-13-7-4-8-14-35)28-32(2)34-16-18-36(19-17-34)37-20-22-38(23-21-37)39-24-26-44-42(29-39)43-25-10-9-15-41(43)30-43;1-4-5-6-7-8(2)3/h3-30H,2H2,1H3;4-7H,1H2,2-3H3/b31-27+,40-28+;6-5- |
| InChIKey | QVKJWKFRSKVDLH-WUNKGVKTSA-N |
| XLogP | 13.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.93 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|