C28H28F7N3O4S2 — CID 145184254
(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-oxo-1,3-thiazolidin-3-yl)-9b-(4-prop-1-en-2-ylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide (PubChem CID 145184254) has the molecular formula C28H28F7N3O4S2 and a molecular weight of 667.67 g/mol. Its IUPAC name is (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-oxo-1,3-thiazolidin-3-yl)-9b-(4-prop-1-en-2-ylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide.
| Compound Name | (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-oxo-1,3-thiazolidin-3-yl)-9b-(4-prop-1-en-2-ylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
|---|---|
| PubChem CID | 145184254 |
| Molecular Formula | C28H28F7N3O4S2 |
| Molecular Weight | 667.67 g/mol |
| Exact Mass | 667.14 |
| IUPAC Name | (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-oxo-1,3-thiazolidin-3-yl)-9b-(4-prop-1-en-2-ylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
| SMILES | C=C(C)c1ccc(S(=O)(=O)[C@@]23CCN(C(=O)NN4CCS(=O)C4)[C@@H]2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C28H28F7N3O4S2/c1-17(2)18-3-7-21(8-4-18)44(41,42)25-11-12-38(24(39)36-37-13-14-43(40)16-37)23(25)10-5-19-15-20(6-9-22(19)25)26(29,27(30,31)32)28(33,34)35/h3-4,6-9,15,23H,1,5,10-14,16H2,2H3,(H,36,39)/t23-,25-,43?/m1/s1 |
| InChIKey | GRLOGNYGBNERAF-XIZVXGNNSA-N |
| XLogP | 5.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |