C48H46N2 — CID 145272412
ethane;N-[[3-[5-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-phenylphenyl]-5-phenylphenyl]-phenylmethylidene]-N'-methylbenzenecarboximidamide (PubChem CID 145272412) has the molecular formula C48H46N2 and a molecular weight of 650.91 g/mol. Its IUPAC name is ethane;N-[[3-[5-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-phenylphenyl]-5-phenylphenyl]-phenylmethylidene]-N'-methylbenzenecarboximidamide.
| Compound Name | ethane;N-[[3-[5-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-phenylphenyl]-5-phenylphenyl]-phenylmethylidene]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 145272412 |
| Molecular Formula | C48H46N2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | ethane;N-[[3-[5-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-phenylphenyl]-5-phenylphenyl]-phenylmethylidene]-N'-methylbenzenecarboximidamide |
| SMILES | C/C=C\C(=C/CC)c1ccc(-c2ccccc2)c(-c2cc(/C(=N/C(=N/C)c3ccccc3)c3ccccc3)cc(-c3ccccc3)c2)c1.CC |
| InChI | InChI=1S/C46H40N2.C2H6/c1-4-18-34(19-5-2)39-28-29-43(36-22-12-7-13-23-36)44(33-39)41-30-40(35-20-10-6-11-21-35)31-42(32-41)45(37-24-14-8-15-25-37)48-46(47-3)38-26-16-9-17-27-38;1-2/h4,6-33H,5H2,1-3H3;1-2H3/b18-4-,34-19+,47-46+,48-45+; |
| InChIKey | ACJUSCNNYWUWDZ-RNKBUKMPSA-N |
| XLogP | 13.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|