C39H72N2O4 — CID 145333542
2-methylpropane;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylprop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) 3,7-dimethylbicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 145333542) has the molecular formula C39H72N2O4 and a molecular weight of 633.02 g/mol. Its IUPAC name is 2-methylpropane;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylprop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) 3,7-dimethylbicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | 2-methylpropane;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylprop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) 3,7-dimethylbicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 145333542 |
| Molecular Formula | C39H72N2O4 |
| Molecular Weight | 633.02 g/mol |
| Exact Mass | 632.55 |
| IUPAC Name | 2-methylpropane;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylprop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) 3,7-dimethylbicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1.CC(C)C.CC1CC2CC(C)CC(C(=O)OC3CC(C)(C)NC(C)(C)C3)(C1)C2 |
| InChI | InChI=1S/C21H37NO2.C14H25NO2.C4H10/c1-14-7-16-8-15(2)10-21(9-14,11-16)18(23)24-17-12-19(3,4)22-20(5,6)13-17;1-10(2)12(16)17-11-8-13(3,4)15(7)14(5,6)9-11;1-4(2)3/h14-17,22H,7-13H2,1-6H3;11H,1,8-9H2,2-7H3;4H,1-3H3 |
| InChIKey | XCQXZTQHPOKSEF-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.02 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|