C23H32 — CID 145428913
(5E)-4-ethyl-4,6,6-trimethyl-1-(4-prop-1-en-2-ylphenyl)-5-propylidenecyclohexene (PubChem CID 145428913) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is (5E)-4-ethyl-4,6,6-trimethyl-1-(4-prop-1-en-2-ylphenyl)-5-propylidenecyclohexene.
| Compound Name | (5E)-4-ethyl-4,6,6-trimethyl-1-(4-prop-1-en-2-ylphenyl)-5-propylidenecyclohexene |
|---|---|
| PubChem CID | 145428913 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (5E)-4-ethyl-4,6,6-trimethyl-1-(4-prop-1-en-2-ylphenyl)-5-propylidenecyclohexene |
| SMILES | C=C(C)c1ccc(C2=CCC(C)(CC)/C(=C\CC)C2(C)C)cc1 |
| InChI | InChI=1S/C23H32/c1-8-10-21-22(5,6)20(15-16-23(21,7)9-2)19-13-11-18(12-14-19)17(3)4/h10-15H,3,8-9,16H2,1-2,4-7H3/b21-10- |
| InChIKey | FRMRKUDEEYTXQL-FBHDLOMBSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|