C35H41F2N3O5S — CID 146247217
(E)-3-[5-[4-(2-butoxyethoxy)cyclohexa-1,5-dien-1-yl]-2-(difluoromethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 146247217) has the molecular formula C35H41F2N3O5S and a molecular weight of 653.79 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)cyclohexa-1,5-dien-1-yl]-2-(difluoromethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)cyclohexa-1,5-dien-1-yl]-2-(difluoromethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247217 |
| Molecular Formula | C35H41F2N3O5S |
| Molecular Weight | 653.79 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)cyclohexa-1,5-dien-1-yl]-2-(difluoromethoxy)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOC1C=CC(c2ccc(OC(F)F)c(/C=C/C(=O)Nc3ccc([S@@](=O)Cc4cncn4CCC)cc3)c2)=CC1 |
| InChI | InChI=1S/C35H41F2N3O5S/c1-3-5-19-43-20-21-44-31-12-6-26(7-13-31)27-8-16-33(45-35(36)37)28(22-27)9-17-34(41)39-29-10-14-32(15-11-29)46(42)24-30-23-38-25-40(30)18-4-2/h6-12,14-17,22-23,25,31,35H,3-5,13,18-21,24H2,1-2H3,(H,39,41)/b17-9+/t31?,46-/m0/s1 |
| InChIKey | GUOXJBPUOBTXQQ-IPAUCUFKSA-N |
| XLogP | 7.40 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.79 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|