C27H28N2O2 — CID 146681027
2-[bis(methylamino)methyl]-4-methylidene-1,3,5-triphenylpentane-1,5-dione (PubChem CID 146681027) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[bis(methylamino)methyl]-4-methylidene-1,3,5-triphenylpentane-1,5-dione.
| Compound Name | 2-[bis(methylamino)methyl]-4-methylidene-1,3,5-triphenylpentane-1,5-dione |
|---|---|
| PubChem CID | 146681027 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-[bis(methylamino)methyl]-4-methylidene-1,3,5-triphenylpentane-1,5-dione |
| SMILES | C=C(C(=O)c1ccccc1)C(c1ccccc1)C(C(=O)c1ccccc1)C(NC)NC |
| InChI | InChI=1S/C27H28N2O2/c1-19(25(30)21-15-9-5-10-16-21)23(20-13-7-4-8-14-20)24(27(28-2)29-3)26(31)22-17-11-6-12-18-22/h4-18,23-24,27-29H,1H2,2-3H3 |
| InChIKey | HMFIPCVAKOLIPO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|