C18H36N3O5S2+ — CID 147165361
[1-[(2-amino-2-carboxyethyl)disulfanyl]-2-[2-(tert-butylamino)propanoyloxy]-5,5-dimethyl-4-oxohexan-3-yl]azanium (PubChem CID 147165361) has the molecular formula C18H36N3O5S2+ and a molecular weight of 438.64 g/mol. Its IUPAC name is [1-[(2-amino-2-carboxyethyl)disulfanyl]-2-[2-(tert-butylamino)propanoyloxy]-5,5-dimethyl-4-oxohexan-3-yl]azanium.
| Compound Name | [1-[(2-amino-2-carboxyethyl)disulfanyl]-2-[2-(tert-butylamino)propanoyloxy]-5,5-dimethyl-4-oxohexan-3-yl]azanium |
|---|---|
| PubChem CID | 147165361 |
| Molecular Formula | C18H36N3O5S2+ |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | [1-[(2-amino-2-carboxyethyl)disulfanyl]-2-[2-(tert-butylamino)propanoyloxy]-5,5-dimethyl-4-oxohexan-3-yl]azanium |
| SMILES | CC(NC(C)(C)C)C(=O)OC(CSSCC(N)C(=O)O)C([NH3+])C(=O)C(C)(C)C |
| InChI | InChI=1S/C18H35N3O5S2/c1-10(21-18(5,6)7)16(25)26-12(13(20)14(22)17(2,3)4)9-28-27-8-11(19)15(23)24/h10-13,21H,8-9,19-20H2,1-7H3,(H,23,24)/p+1 |
| InChIKey | BWQUNAGUYCCLSP-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|