C13H17ClN2O6 — CID 14796730
3-O-methyl 1-O,2-O-bis(prop-2-enyl) 4-chloropyrazolidine-1,2,3-tricarboxylate (PubChem CID 14796730) has the molecular formula C13H17ClN2O6 and a molecular weight of 332.74 g/mol. Its IUPAC name is 3-O-methyl 1-O,2-O-bis(prop-2-enyl) 4-chloropyrazolidine-1,2,3-tricarboxylate.
| Compound Name | 3-O-methyl 1-O,2-O-bis(prop-2-enyl) 4-chloropyrazolidine-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 14796730 |
| Molecular Formula | C13H17ClN2O6 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-O-methyl 1-O,2-O-bis(prop-2-enyl) 4-chloropyrazolidine-1,2,3-tricarboxylate |
| SMILES | C=CCOC(=O)N1CC(Cl)C(C(=O)OC)N1C(=O)OCC=C |
| InChI | InChI=1S/C13H17ClN2O6/c1-4-6-21-12(18)15-8-9(14)10(11(17)20-3)16(15)13(19)22-7-5-2/h4-5,9-10H,1-2,6-8H2,3H3 |
| InChIKey | WITKKKKQLKBBIZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|