C32H25IN2O5 — CID 148550071
methyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylate (PubChem CID 148550071) has the molecular formula C32H25IN2O5 and a molecular weight of 644.47 g/mol. Its IUPAC name is methyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylate.
| Compound Name | methyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylate |
|---|---|
| PubChem CID | 148550071 |
| Molecular Formula | C32H25IN2O5 |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 644.08 |
| IUPAC Name | methyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-6-hydroxy-3-iodo-1-methylindole-5-carboxylate |
| SMILES | COC(=O)c1cc2c(I)c(-c3cccc(NC(=O)OCC4c5ccccc5-c5ccccc54)c3)n(C)c2cc1O |
| InChI | InChI=1S/C32H25IN2O5/c1-35-27-16-28(36)25(31(37)39-2)15-24(27)29(33)30(35)18-8-7-9-19(14-18)34-32(38)40-17-26-22-12-5-3-10-20(22)21-11-4-6-13-23(21)26/h3-16,26,36H,17H2,1-2H3,(H,34,38) |
| InChIKey | OCQJIUFVNZMBKB-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|