C9H4F10NP — CID 151367997
[2,6-bis(1,1,2,2,2-pentafluoroethyl)-4-pyridinyl]phosphane (PubChem CID 151367997) has the molecular formula C9H4F10NP and a molecular weight of 347.09 g/mol. Its IUPAC name is [2,6-bis(1,1,2,2,2-pentafluoroethyl)-4-pyridinyl]phosphane.
| Compound Name | [2,6-bis(1,1,2,2,2-pentafluoroethyl)-4-pyridinyl]phosphane |
|---|---|
| PubChem CID | 151367997 |
| Molecular Formula | C9H4F10NP |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | [2,6-bis(1,1,2,2,2-pentafluoroethyl)-4-pyridinyl]phosphane |
| SMILES | FC(F)(F)C(F)(F)c1cc(P)cc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H4F10NP/c10-6(11,8(14,15)16)4-1-3(21)2-5(20-4)7(12,13)9(17,18)19/h1-2H,21H2 |
| InChIKey | OPVJFMFIHIWGQJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|