C28H27F6NO2 — CID 151600918
4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,2,3-trimethyl-5-phenylpentanamide (PubChem CID 151600918) has the molecular formula C28H27F6NO2 and a molecular weight of 523.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,2,3-trimethyl-5-phenylpentanamide.
| Compound Name | 4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,2,3-trimethyl-5-phenylpentanamide |
|---|---|
| PubChem CID | 151600918 |
| Molecular Formula | C28H27F6NO2 |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,2,3-trimethyl-5-phenylpentanamide |
| SMILES | CC(C(C)(C)C(N)=O)C(Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C28H27F6NO2/c1-17(26(2,3)25(35)36)27(16-18-7-5-4-6-8-18,19-9-11-21(29)12-10-19)20-13-22(30)15-23(14-20)37-28(33,34)24(31)32/h4-15,17,24H,16H2,1-3H3,(H2,35,36) |
| InChIKey | QKLVJURQYQQWJP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|