HAsO8P2 — CID 151672634
3-hydroxy-2,4,6,7-tetraoxa-1λ5,3λ5-diphospha-5λ5-arsabicyclo[3.1.1]heptane 1,3,5-trioxide (PubChem CID 151672634) has the molecular formula HAsO8P2 and a molecular weight of 265.87 g/mol. Its IUPAC name is 3-hydroxy-2,4,6,7-tetraoxa-1λ5,3λ5-diphospha-5λ5-arsabicyclo[3.1.1]heptane 1,3,5-trioxide.
| Compound Name | 3-hydroxy-2,4,6,7-tetraoxa-1λ5,3λ5-diphospha-5λ5-arsabicyclo[3.1.1]heptane 1,3,5-trioxide |
|---|---|
| PubChem CID | 151672634 |
| Molecular Formula | HAsO8P2 |
| Molecular Weight | 265.87 g/mol |
| Exact Mass | 265.84 |
| IUPAC Name | 3-hydroxy-2,4,6,7-tetraoxa-1λ5,3λ5-diphospha-5λ5-arsabicyclo[3.1.1]heptane 1,3,5-trioxide |
| SMILES | O=P1(O)OP2(=O)O[As](=O)(O1)O2 |
| InChI | InChI=1S/AsHO8P2/c2-1-6-10(3,4)9-11(5,7-1)8-1/h(H,3,4) |
| InChIKey | QYWKFZPKUWNFSS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.87 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|