About 4-nitrooctanenitrile
4-nitrooctanenitrile (PubChem CID 15271599) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-nitrooctanenitrile.
Molecular Properties
| Compound Name | 4-nitrooctanenitrile |
| PubChem CID | 15271599 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-nitrooctanenitrile |
| SMILES | CCCCC(CCC#N)[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N2O2/c1-2-3-5-8(10(11)12)6-4-7-9/h8H,2-6H2,1H3 |
| InChIKey | SFAQLEXSKZSQHY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrooctanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrooctanenitrile?
The IUPAC name of 4-nitrooctanenitrile (CID 15271599) is 4-nitrooctanenitrile.
What is the SMILES notation for 4-nitrooctanenitrile?
The canonical SMILES for 4-nitrooctanenitrile is CCCCC(CCC#N)[N+](=O)[O-].
What is the InChIKey of 4-nitrooctanenitrile?
The InChIKey is SFAQLEXSKZSQHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-2-3-5-8(10(11)12)6-4-7-9/h8H,2-6H2,1H3.
What are the key properties of 4-nitrooctanenitrile?
4-nitrooctanenitrile has a molecular weight of 170.21 g/mol, XLogP of 2.13, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrooctanenitrile is sourced from PubChem (CID 15271599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).