C22H39FO5 — CID 152747703
7-[(8S,9R)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 152747703) has the molecular formula C22H39FO5 and a molecular weight of 402.55 g/mol. Its IUPAC name is 7-[(8S,9R)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 7-[(8S,9R)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 152747703 |
| Molecular Formula | C22H39FO5 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 7-[(8S,9R)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | CCCCC(F)[C@@H](O)CC[C@H]1CCC2(OCCO2)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H39FO5/c1-2-3-9-19(23)20(24)12-11-17-13-14-22(27-15-16-28-22)18(17)8-6-4-5-7-10-21(25)26/h17-20,24H,2-16H2,1H3,(H,25,26)/t17-,18+,19?,20-/m0/s1 |
| InChIKey | HDLCGKHSCIMPTM-XNMUZJSGSA-N |
| XLogP | 4.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|