C20H29N3O4 — CID 153456082
(2S)-2-amino-3-[4-[(E)-N-[(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)methoxy]-C-methylcarbonimidoyl]phenyl]propanoic acid (PubChem CID 153456082) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[(E)-N-[(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)methoxy]-C-methylcarbonimidoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[(E)-N-[(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)methoxy]-C-methylcarbonimidoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 153456082 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2S)-2-amino-3-[4-[(E)-N-[(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)methoxy]-C-methylcarbonimidoyl]phenyl]propanoic acid |
| SMILES | C/C(=N\OCC1=CC(C)(C)N(O)C1(C)C)c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C20H29N3O4/c1-13(15-8-6-14(7-9-15)10-17(21)18(24)25)22-27-12-16-11-19(2,3)23(26)20(16,4)5/h6-9,11,17,26H,10,12,21H2,1-5H3,(H,24,25)/b22-13+/t17-/m0/s1 |
| InChIKey | HZGBASDFJSQSOZ-KOWBDXASSA-N |
| XLogP | 2.57 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|