C20H22Cl4 — CID 15351278
(1R,2R,3S,6R,7S,8S,9R,10S,11S,12R,13R,14S)-1,8,15,16-tetrachloro-11,12-dideuteriohexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,15-diene (PubChem CID 15351278) has the molecular formula C20H22Cl4 and a molecular weight of 406.22 g/mol. Its IUPAC name is (1R,2R,3S,6R,7S,8S,9R,10S,11S,12R,13R,14S)-1,8,15,16-tetrachloro-11,12-dideuteriohexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,15-diene.
| Compound Name | (1R,2R,3S,6R,7S,8S,9R,10S,11S,12R,13R,14S)-1,8,15,16-tetrachloro-11,12-dideuteriohexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,15-diene |
|---|---|
| PubChem CID | 15351278 |
| Molecular Formula | C20H22Cl4 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (1R,2R,3S,6R,7S,8S,9R,10S,11S,12R,13R,14S)-1,8,15,16-tetrachloro-11,12-dideuteriohexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,15-diene |
| SMILES | [2H][C@@H]1[C@H]([2H])[C@@H]2CC[C@H]1[C@H]1[C@@H]2[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)[C@H]1[C@@H]2[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C20H22Cl4/c21-17-18(22)20(24)14-10-2-1-9(3-4-10)13(14)19(17,23)15-11-5-7-12(8-6-11)16(15)20/h1-2,9-16H,3-8H2/t9-,10+,11-,12+,13-,14+,15+,16-,19+,20-/i5D,7D/t5-,7+,9-,10+,11+,12-,13-,14+,15+,16-,19+,20- |
| InChIKey | BBTMBPSVBBFVEL-UHMGWNSLSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|