C26H37O3P — CID 154186362
11,15-ditert-butyl-8-hydroxy-4,13-dimethyl-2-propyl-7,9-dioxa-8-phosphatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene (PubChem CID 154186362) has the molecular formula C26H37O3P and a molecular weight of 428.55 g/mol. Its IUPAC name is 11,15-ditert-butyl-8-hydroxy-4,13-dimethyl-2-propyl-7,9-dioxa-8-phosphatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene.
| Compound Name | 11,15-ditert-butyl-8-hydroxy-4,13-dimethyl-2-propyl-7,9-dioxa-8-phosphatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene |
|---|---|
| PubChem CID | 154186362 |
| Molecular Formula | C26H37O3P |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 11,15-ditert-butyl-8-hydroxy-4,13-dimethyl-2-propyl-7,9-dioxa-8-phosphatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene |
| SMILES | CCCC1c2cc(C(C)(C)C)c(cc2C)OP(O)Oc2cc(C)c1cc2C(C)(C)C |
| InChI | InChI=1S/C26H37O3P/c1-10-11-18-19-14-21(25(4,5)6)23(12-16(19)2)28-30(27)29-24-13-17(3)20(18)15-22(24)26(7,8)9/h12-15,18,27H,10-11H2,1-9H3 |
| InChIKey | HRZITZCEQDAPPC-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|