About 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine
2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine (PubChem CID 154360243) has the molecular formula C7H6F6O
and a molecular weight of 220.11 g/mol. Its IUPAC name is 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine.
Analyze 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine?
The IUPAC name of 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine (CID 154360243) is 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine.
What is the SMILES notation for 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine?
The canonical SMILES for 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine is FC(F)(F)C1(F)CCC=COC1(F)F.
What is the InChIKey of 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine?
The InChIKey is ULCODHKQRYPMNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F6O/c8-5(6(9,10)11)3-1-2-4-14-7(5,12)13/h2,4H,1,3H2.
What are the key properties of 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine?
2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine has a molecular weight of 220.11 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-trifluoro-3-(trifluoromethyl)-4,5-dihydrooxepine is sourced from PubChem (CID 154360243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).