C21H28F3N7O3 — CID 154541662
[3-amino-1-[7-but-2-ynyl-2-(diethylamino)-1-methyl-6-oxopurin-8-yl]piperidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 154541662) has the molecular formula C21H28F3N7O3 and a molecular weight of 483.50 g/mol. Its IUPAC name is [3-amino-1-[7-but-2-ynyl-2-(diethylamino)-1-methyl-6-oxopurin-8-yl]piperidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-amino-1-[7-but-2-ynyl-2-(diethylamino)-1-methyl-6-oxopurin-8-yl]piperidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154541662 |
| Molecular Formula | C21H28F3N7O3 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | [3-amino-1-[7-but-2-ynyl-2-(diethylamino)-1-methyl-6-oxopurin-8-yl]piperidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CC#CCn1c(N2CCC(OC(=O)C(F)(F)F)C(N)C2)nc2nc(N(CC)CC)n(C)c(=O)c21 |
| InChI | InChI=1S/C21H28F3N7O3/c1-5-8-10-31-15-16(26-19(28(4)17(15)32)29(6-2)7-3)27-20(31)30-11-9-14(13(25)12-30)34-18(33)21(22,23)24/h13-14H,6-7,9-12,25H2,1-4H3 |
| InChIKey | CKOLZVVHFKJWNE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|